How do you name Alkanols?
The primary suffix name is .. ol for alcohol and so for the longest carbon chain (alkanol) the names are based on: 1 carbon atom, methanol; 2 carbons, ethanol; 3 carbons, propanol; 4 carbons, butanol.
What is an alkane’s general formula?
Alkanes have the general chemical formula C nH 2n+2. In an alkane, each carbon atom is sp3-hybridized with 4 sigma bonds (either C–C or C–H), and each hydrogen atom is joined to one of the carbon atoms (in a C–H bond).
How is methane liquefied?
Methane cannot be condensed to a liquid by pressure at ordinary temperatures because the critical temperature3 of methane is −82.1 ºC. Natural gas can be liquefied at a pressure of 45.8 atm at or below its critical point temperature of −82.1 ºC to form liquefied natural gas (LNG)3 for commercial transport.
What is the condensed structural formula for 2 2 dimethylpropane?
2,2-dimethylpropane
| Compound number: | MolPort-006-109-600 |
|---|---|
| IUPAC traditional: | neopentane |
| SMILES: | CC(C)(C)C |
| InChI key: | CRSOQBOWXPBRES-UHFFFAOYSA-N |
| Molecular formula: | C5H12 |
What is the condensed formula of 2 Methylpropane?
Showing Compound 2-Methylpropane (FDB000755)
| Record Information | |
|---|---|
| Chemical Formula | C4H10 |
| IUPAC name | 2-methylpropane |
| InChI Identifier | InChI=1S/C4H10/c1-4(2)3/h4H,1-3H3 |
| InChI Key | NNPPMTNAJDCUHE-UHFFFAOYSA-N |
What is another name for alkanols and the general formula?
Boiling Point
| Primary Alkanols | ||
|---|---|---|
| Preferred IUPAC name (alternative IUPAC name) | Functional name | Semi-Structural Formula |
| ethanol | ethyl alcohol | CH3-CH2-OH |
| propan-1-ol (1-propanol) | n-propyl alcohol | CH3-CH2-CH2-OH |
| butan-1-ol (1-butanol) | n-butyl alcohol | CH3-CH2-CH2-CH2-OH |
What is an alkanols?
Definition of alkanol : an aliphatic alcohol (such as methanol) regarded as derived from an alkane.
What is the general formula of alkyne and alkyl?
The simplest alkyne, ethyne has two carbon atoms and having molecular formula C2H2 . 4. Alkyl. An alkyl group is formed by removing one hydrogen from alkane which makes the general formula of alkyl as CnH2n+1 .
What is the general formula of alkene and alkyne?
Alkenes have the general formula CnH2n. The general formula for alkynes is CnH2n-2. Acetylene is the simplest alkyne with the formula as C2H2. Alkanes are non-polar compounds and insoluble in water.